C17H23NO7S — CID 141131112
1-O-tert-butyl 2-O-(4-methylphenyl)sulfonyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate (PubChem CID 141131112) has the molecular formula C17H23NO7S and a molecular weight of 385.44 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-(4-methylphenyl)sulfonyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-(4-methylphenyl)sulfonyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 141131112 |
| Molecular Formula | C17H23NO7S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 1-O-tert-butyl 2-O-(4-methylphenyl)sulfonyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OC(=O)[C@@H]2C[C@@H](O)CN2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H23NO7S/c1-11-5-7-13(8-6-11)26(22,23)25-15(20)14-9-12(19)10-18(14)16(21)24-17(2,3)4/h5-8,12,14,19H,9-10H2,1-4H3/t12-,14+/m1/s1 |
| InChIKey | CRDPXHYFRDIDLC-OCCSQVGLSA-N |
| XLogP | 1.60 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|