C14H24N4O2 — CID 141142867
3,7,9-tripropyl-8H-purine-2,6-dione (PubChem CID 141142867) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 3,7,9-tripropyl-8H-purine-2,6-dione.
| Compound Name | 3,7,9-tripropyl-8H-purine-2,6-dione |
|---|---|
| PubChem CID | 141142867 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 3,7,9-tripropyl-8H-purine-2,6-dione |
| SMILES | CCCN1CN(CCC)c2c1c(=O)[nH]c(=O)n2CCC |
| InChI | InChI=1S/C14H24N4O2/c1-4-7-16-10-17(8-5-2)13-11(16)12(19)15-14(20)18(13)9-6-3/h4-10H2,1-3H3,(H,15,19,20) |
| InChIKey | VMFZZIBYELECOL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |