About 3-methylbutyl hypobromite
3-methylbutyl hypobromite (PubChem CID 141146646) has the molecular formula C5H11BrO
and a molecular weight of 167.05 g/mol. Its IUPAC name is 3-methylbutyl hypobromite.
Molecular Properties
| Compound Name | 3-methylbutyl hypobromite |
| PubChem CID | 141146646 |
| Molecular Formula | C5H11BrO |
| Molecular Weight | 167.05 g/mol |
| Exact Mass | 166.00 |
| IUPAC Name | 3-methylbutyl hypobromite |
| SMILES | CC(C)CCOBr |
| InChI | InChI=1S/C5H11BrO/c1-5(2)3-4-7-6/h5H,3-4H2,1-2H3 |
| InChIKey | KIMHBJKCEVCDBX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.05 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methylbutyl hypobromite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutyl hypobromite?
The IUPAC name of 3-methylbutyl hypobromite (CID 141146646) is 3-methylbutyl hypobromite.
What is the SMILES notation for 3-methylbutyl hypobromite?
The canonical SMILES for 3-methylbutyl hypobromite is CC(C)CCOBr.
What is the InChIKey of 3-methylbutyl hypobromite?
The InChIKey is KIMHBJKCEVCDBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11BrO/c1-5(2)3-4-7-6/h5H,3-4H2,1-2H3.
What are the key properties of 3-methylbutyl hypobromite?
3-methylbutyl hypobromite has a molecular weight of 167.05 g/mol, XLogP of 2.36, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutyl hypobromite is sourced from PubChem (CID 141146646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).