About 3-methylbutoxygallane
3-methylbutoxygallane (PubChem CID 174485666) has the molecular formula C5H13GaO
and a molecular weight of 158.88 g/mol. Its IUPAC name is 3-methylbutoxygallane.
Molecular Properties
| Compound Name | 3-methylbutoxygallane |
| PubChem CID | 174485666 |
| Molecular Formula | C5H13GaO |
| Molecular Weight | 158.88 g/mol |
| Exact Mass | 158.02 |
| IUPAC Name | 3-methylbutoxygallane |
| SMILES | CC(C)CCO[GaH2] |
| InChI | InChI=1S/C5H11O.Ga.2H/c1-5(2)3-4-6;;;/h5H,3-4H2,1-2H3;;;/q-1;+1;; |
| InChIKey | KYGBWCPYFRUFQI-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.88 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methylbutoxygallane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutoxygallane?
The IUPAC name of 3-methylbutoxygallane (CID 174485666) is 3-methylbutoxygallane.
What is the SMILES notation for 3-methylbutoxygallane?
The canonical SMILES for 3-methylbutoxygallane is CC(C)CCO[GaH2].
What is the InChIKey of 3-methylbutoxygallane?
The InChIKey is KYGBWCPYFRUFQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11O.Ga.2H/c1-5(2)3-4-6;;;/h5H,3-4H2,1-2H3;;;/q-1;+1;;.
What are the key properties of 3-methylbutoxygallane?
3-methylbutoxygallane has a molecular weight of 158.88 g/mol, XLogP of 0.60, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutoxygallane is sourced from PubChem (CID 174485666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).