About 3-methylbutoxyphosphane;hydrobromide
3-methylbutoxyphosphane;hydrobromide (PubChem CID 175546648) has the molecular formula C5H14BrOP
and a molecular weight of 201.04 g/mol. Its IUPAC name is 3-methylbutoxyphosphane;hydrobromide.
Molecular Properties
| Compound Name | 3-methylbutoxyphosphane;hydrobromide |
| PubChem CID | 175546648 |
| Molecular Formula | C5H14BrOP |
| Molecular Weight | 201.04 g/mol |
| Exact Mass | 200.00 |
| IUPAC Name | 3-methylbutoxyphosphane;hydrobromide |
| SMILES | Br.CC(C)CCOP |
| InChI | InChI=1S/C5H13OP.BrH/c1-5(2)3-4-6-7;/h5H,3-4,7H2,1-2H3;1H |
| InChIKey | DLKKASXRZGDDEP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.04 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutoxyphosphane;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutoxyphosphane;hydrobromide?
The IUPAC name of 3-methylbutoxyphosphane;hydrobromide (CID 175546648) is 3-methylbutoxyphosphane;hydrobromide.
What is the SMILES notation for 3-methylbutoxyphosphane;hydrobromide?
The canonical SMILES for 3-methylbutoxyphosphane;hydrobromide is Br.CC(C)CCOP.
What is the InChIKey of 3-methylbutoxyphosphane;hydrobromide?
The InChIKey is DLKKASXRZGDDEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13OP.BrH/c1-5(2)3-4-6-7;/h5H,3-4,7H2,1-2H3;1H.
What are the key properties of 3-methylbutoxyphosphane;hydrobromide?
3-methylbutoxyphosphane;hydrobromide has a molecular weight of 201.04 g/mol, XLogP of 2.42, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutoxyphosphane;hydrobromide is sourced from PubChem (CID 175546648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).