C41H38F6O4 — CID 141149711
3-[2-(1-adamantyl)ethynyl]-5-[2-[3-[2-(1-adamantyl)ethynyl]-5-carboxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzoic acid (PubChem CID 141149711) has the molecular formula C41H38F6O4 and a molecular weight of 708.74 g/mol. Its IUPAC name is 3-[2-(1-adamantyl)ethynyl]-5-[2-[3-[2-(1-adamantyl)ethynyl]-5-carboxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzoic acid.
| Compound Name | 3-[2-(1-adamantyl)ethynyl]-5-[2-[3-[2-(1-adamantyl)ethynyl]-5-carboxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 141149711 |
| Molecular Formula | C41H38F6O4 |
| Molecular Weight | 708.74 g/mol |
| Exact Mass | 708.27 |
| IUPAC Name | 3-[2-(1-adamantyl)ethynyl]-5-[2-[3-[2-(1-adamantyl)ethynyl]-5-carboxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzoic acid |
| SMILES | O=C(O)c1cc(C#CC23CC4CC(CC(C4)C2)C3)cc(C(c2cc(C#CC34CC5CC(CC(C5)C3)C4)cc(C(=O)O)c2)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C41H38F6O4/c42-40(43,44)39(41(45,46)47,33-13-23(11-31(15-33)35(48)49)1-3-37-17-25-5-26(18-37)7-27(6-25)19-37)34-14-24(12-32(16-34)36(50)51)2-4-38-20-28-8-29(21-38)10-30(9-28)22-38/h11-16,25-30H,5-10,17-22H2,(H,48,49)(H,50,51) |
| InChIKey | MBUMRYPIADQERQ-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.74 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|