C23H28 — CID 141149890
6-(4-ethenylocta-2,5-dien-4-yl)-6-ethynylundec-7-en-2,4-diyne (PubChem CID 141149890) has the molecular formula C23H28 and a molecular weight of 304.48 g/mol. Its IUPAC name is 6-(4-ethenylocta-2,5-dien-4-yl)-6-ethynylundec-7-en-2,4-diyne.
| Compound Name | 6-(4-ethenylocta-2,5-dien-4-yl)-6-ethynylundec-7-en-2,4-diyne |
|---|---|
| PubChem CID | 141149890 |
| Molecular Formula | C23H28 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 6-(4-ethenylocta-2,5-dien-4-yl)-6-ethynylundec-7-en-2,4-diyne |
| SMILES | C#CC(C#CC#CC)(C=CCCC)C(C=C)(C=CC)C=CCC |
| InChI | InChI=1S/C23H28/c1-7-13-16-20-23(12-6,21-17-14-8-2)22(11-5,18-10-4)19-15-9-3/h6,10-11,15-16,18-20H,5,7,9,13H2,1-4H3 |
| InChIKey | QTXPJIZLVZGNMF-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|