C16H10Cl3N5O2 — CID 141152111
N-(6-chloro-3-pyridinyl)-4-[(2,4-dichlorobenzoyl)amino]-1H-pyrazole-5-carboxamide (PubChem CID 141152111) has the molecular formula C16H10Cl3N5O2 and a molecular weight of 410.65 g/mol. Its IUPAC name is N-(6-chloro-3-pyridinyl)-4-[(2,4-dichlorobenzoyl)amino]-1H-pyrazole-5-carboxamide.
| Compound Name | N-(6-chloro-3-pyridinyl)-4-[(2,4-dichlorobenzoyl)amino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 141152111 |
| Molecular Formula | C16H10Cl3N5O2 |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | N-(6-chloro-3-pyridinyl)-4-[(2,4-dichlorobenzoyl)amino]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1cn[nH]c1C(=O)Nc1ccc(Cl)nc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H10Cl3N5O2/c17-8-1-3-10(11(18)5-8)15(25)23-12-7-21-24-14(12)16(26)22-9-2-4-13(19)20-6-9/h1-7H,(H,21,24)(H,22,26)(H,23,25) |
| InChIKey | BGNJIPWQTMKIIQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|