C8H15N3O2S — CID 141152483
1,3-diethyl-6-hydroxy-5-imino-2-sulfanyl-1,3-diazinan-4-one (PubChem CID 141152483) has the molecular formula C8H15N3O2S and a molecular weight of 217.29 g/mol. Its IUPAC name is 1,3-diethyl-6-hydroxy-5-imino-2-sulfanyl-1,3-diazinan-4-one.
| Compound Name | 1,3-diethyl-6-hydroxy-5-imino-2-sulfanyl-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 141152483 |
| Molecular Formula | C8H15N3O2S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 1,3-diethyl-6-hydroxy-5-imino-2-sulfanyl-1,3-diazinan-4-one |
| SMILES | [H]/N=C1\C(=O)N(CC)C(S)N(CC)C1O |
| InChI | InChI=1S/C8H15N3O2S/c1-3-10-6(12)5(9)7(13)11(4-2)8(10)14/h6,8-9,12,14H,3-4H2,1-2H3/b9-5- |
| InChIKey | ZWNHLQTUNOEVKK-UITAMQMPSA-N |
| XLogP | -0.28 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|