C12H15N3O — CID 141155324
1,3,4,4a,5,5a-hexahydropyrido[4,3-b]indole-2-carboxamide (PubChem CID 141155324) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 1,3,4,4a,5,5a-hexahydropyrido[4,3-b]indole-2-carboxamide.
| Compound Name | 1,3,4,4a,5,5a-hexahydropyrido[4,3-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 141155324 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 1,3,4,4a,5,5a-hexahydropyrido[4,3-b]indole-2-carboxamide |
| SMILES | NC(=O)N1CCC2NC3C=CC=CC3=C2C1 |
| InChI | InChI=1S/C12H15N3O/c13-12(16)15-6-5-11-9(7-15)8-3-1-2-4-10(8)14-11/h1-4,10-11,14H,5-7H2,(H2,13,16) |
| InChIKey | TVSIHPWGGSMLRF-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |