C25H21N3OS2 — CID 141157815
5-[(Z)-2-[(2-aminophenyl)-diphenylmethyl]sulfanylethenyl]-1,3-thiazole-4-carboxamide (PubChem CID 141157815) has the molecular formula C25H21N3OS2 and a molecular weight of 443.60 g/mol. Its IUPAC name is 5-[(Z)-2-[(2-aminophenyl)-diphenylmethyl]sulfanylethenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 5-[(Z)-2-[(2-aminophenyl)-diphenylmethyl]sulfanylethenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 141157815 |
| Molecular Formula | C25H21N3OS2 |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 5-[(Z)-2-[(2-aminophenyl)-diphenylmethyl]sulfanylethenyl]-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)c1ncsc1/C=C\SC(c1ccccc1)(c1ccccc1)c1ccccc1N |
| InChI | InChI=1S/C25H21N3OS2/c26-21-14-8-7-13-20(21)25(18-9-3-1-4-10-18,19-11-5-2-6-12-19)31-16-15-22-23(24(27)29)28-17-30-22/h1-17H,26H2,(H2,27,29)/b16-15- |
| InChIKey | ULNISRITLBDKOS-NXVVXOECSA-N |
| XLogP | 5.52 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|