C25H20N2OS2 — CID 68598433
5-(2-tritylsulfanylethenyl)-1,3-thiazole-4-carboxamide (PubChem CID 68598433) has the molecular formula C25H20N2OS2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 5-(2-tritylsulfanylethenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 5-(2-tritylsulfanylethenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 68598433 |
| Molecular Formula | C25H20N2OS2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 5-(2-tritylsulfanylethenyl)-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)c1ncsc1C=CSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H20N2OS2/c26-24(28)23-22(29-18-27-23)16-17-30-25(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-18H,(H2,26,28) |
| InChIKey | IKXPOLVUVOCXEE-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|