C26H21NO2S2 — CID 68598838
methyl 5-[(E)-2-tritylsulfanylethenyl]-1,3-thiazole-4-carboxylate (PubChem CID 68598838) has the molecular formula C26H21NO2S2 and a molecular weight of 443.59 g/mol. Its IUPAC name is methyl 5-[(E)-2-tritylsulfanylethenyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 5-[(E)-2-tritylsulfanylethenyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 68598838 |
| Molecular Formula | C26H21NO2S2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | methyl 5-[(E)-2-tritylsulfanylethenyl]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1ncsc1/C=C/SC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H21NO2S2/c1-29-25(28)24-23(30-19-27-24)17-18-31-26(20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-19H,1H3/b18-17+ |
| InChIKey | YTEXBUYUVSVOJK-ISLYRVAYSA-N |
| XLogP | 6.63 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|