C27H48O2Si2 — CID 141158620
tert-butyl-[(5S,8E,10E,12R)-12-[tert-butyl(dimethyl)silyl]oxypentadeca-8,10-dien-6,14-diyn-5-yl]oxy-dimethylsilane (PubChem CID 141158620) has the molecular formula C27H48O2Si2 and a molecular weight of 460.85 g/mol. Its IUPAC name is tert-butyl-[(5S,8E,10E,12R)-12-[tert-butyl(dimethyl)silyl]oxypentadeca-8,10-dien-6,14-diyn-5-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(5S,8E,10E,12R)-12-[tert-butyl(dimethyl)silyl]oxypentadeca-8,10-dien-6,14-diyn-5-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 141158620 |
| Molecular Formula | C27H48O2Si2 |
| Molecular Weight | 460.85 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | tert-butyl-[(5S,8E,10E,12R)-12-[tert-butyl(dimethyl)silyl]oxypentadeca-8,10-dien-6,14-diyn-5-yl]oxy-dimethylsilane |
| SMILES | C#CC[C@H](/C=C/C=C/C#C[C@H](CCCC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H48O2Si2/c1-13-15-21-25(29-31(11,12)27(6,7)8)23-19-17-16-18-22-24(20-14-2)28-30(9,10)26(3,4)5/h2,16-18,22,24-25H,13,15,20-21H2,1,3-12H3/b17-16+,22-18+/t24-,25+/m1/s1 |
| InChIKey | DRCVWXRZRVKFDL-AGEXODFMSA-N |
| XLogP | 8.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.85 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|