C22H19FO4S — CID 141158876
2-[[7-(3-fluorophenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]-4-methylbenzenesulfonic acid (PubChem CID 141158876) has the molecular formula C22H19FO4S and a molecular weight of 398.46 g/mol. Its IUPAC name is 2-[[7-(3-fluorophenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]-4-methylbenzenesulfonic acid.
| Compound Name | 2-[[7-(3-fluorophenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 141158876 |
| Molecular Formula | C22H19FO4S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 2-[[7-(3-fluorophenyl)-2,3-dihydro-1-benzofuran-2-yl]methyl]-4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(CC2Cc3cccc(-c4cccc(F)c4)c3O2)c1 |
| InChI | InChI=1S/C22H19FO4S/c1-14-8-9-21(28(24,25)26)17(10-14)13-19-12-16-5-3-7-20(22(16)27-19)15-4-2-6-18(23)11-15/h2-11,19H,12-13H2,1H3,(H,24,25,26) |
| InChIKey | OOMUIFNTHWGNKW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|