C23H20ClFO5S — CID 87636850
2-[[7-(3-chloro-4-fluorophenyl)-5-methoxy-2,3-dihydro-1-benzofuran-2-yl]methyl]-4-methylbenzenesulfonic acid (PubChem CID 87636850) has the molecular formula C23H20ClFO5S and a molecular weight of 462.93 g/mol. Its IUPAC name is 2-[[7-(3-chloro-4-fluorophenyl)-5-methoxy-2,3-dihydro-1-benzofuran-2-yl]methyl]-4-methylbenzenesulfonic acid.
| Compound Name | 2-[[7-(3-chloro-4-fluorophenyl)-5-methoxy-2,3-dihydro-1-benzofuran-2-yl]methyl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87636850 |
| Molecular Formula | C23H20ClFO5S |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 2-[[7-(3-chloro-4-fluorophenyl)-5-methoxy-2,3-dihydro-1-benzofuran-2-yl]methyl]-4-methylbenzenesulfonic acid |
| SMILES | COc1cc2c(c(-c3ccc(F)c(Cl)c3)c1)OC(Cc1cc(C)ccc1S(=O)(=O)O)C2 |
| InChI | InChI=1S/C23H20ClFO5S/c1-13-3-6-22(31(26,27)28)15(7-13)8-18-10-16-9-17(29-2)12-19(23(16)30-18)14-4-5-21(25)20(24)11-14/h3-7,9,11-12,18H,8,10H2,1-2H3,(H,26,27,28) |
| InChIKey | RGJUJPHLIOFLHA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|