C44H52O6 — CID 141166927
3-[[1-[2-(1-adamantyl)-1-adamantyl]-2-(3-carboxyphenoxy)-2-adamantyl]oxy]benzoic acid (PubChem CID 141166927) has the molecular formula C44H52O6 and a molecular weight of 676.89 g/mol. Its IUPAC name is 3-[[1-[2-(1-adamantyl)-1-adamantyl]-2-(3-carboxyphenoxy)-2-adamantyl]oxy]benzoic acid.
| Compound Name | 3-[[1-[2-(1-adamantyl)-1-adamantyl]-2-(3-carboxyphenoxy)-2-adamantyl]oxy]benzoic acid |
|---|---|
| PubChem CID | 141166927 |
| Molecular Formula | C44H52O6 |
| Molecular Weight | 676.89 g/mol |
| Exact Mass | 676.38 |
| IUPAC Name | 3-[[1-[2-(1-adamantyl)-1-adamantyl]-2-(3-carboxyphenoxy)-2-adamantyl]oxy]benzoic acid |
| SMILES | O=C(O)c1cccc(OC2(Oc3cccc(C(=O)O)c3)C3CC4CC(C3)CC2(C23CC5CC(CC(C5)C2C25CC6CC(CC(C6)C2)C5)C3)C4)c1 |
| InChI | InChI=1S/C44H52O6/c45-39(46)32-3-1-5-36(16-32)49-44(50-37-6-2-4-33(17-37)40(47)48)35-14-30-11-31(15-35)24-43(44,23-30)42-21-28-10-29(22-42)13-34(12-28)38(42)41-18-25-7-26(19-41)9-27(8-25)20-41/h1-6,16-17,25-31,34-35,38H,7-15,18-24H2,(H,45,46)(H,47,48) |
| InChIKey | SGHNTSNBKHTXIL-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.89 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|