C12H14BrNO5 — CID 141168192
(2S)-2-[(5-bromo-2-hydroxyphenyl)methylamino]pentanedioic acid (PubChem CID 141168192) has the molecular formula C12H14BrNO5 and a molecular weight of 332.15 g/mol. Its IUPAC name is (2S)-2-[(5-bromo-2-hydroxyphenyl)methylamino]pentanedioic acid.
| Compound Name | (2S)-2-[(5-bromo-2-hydroxyphenyl)methylamino]pentanedioic acid |
|---|---|
| PubChem CID | 141168192 |
| Molecular Formula | C12H14BrNO5 |
| Molecular Weight | 332.15 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | (2S)-2-[(5-bromo-2-hydroxyphenyl)methylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NCc1cc(Br)ccc1O)C(=O)O |
| InChI | InChI=1S/C12H14BrNO5/c13-8-1-3-10(15)7(5-8)6-14-9(12(18)19)2-4-11(16)17/h1,3,5,9,14-15H,2,4,6H2,(H,16,17)(H,18,19)/t9-/m0/s1 |
| InChIKey | PEAPUJNUZFAEPW-VIFPVBQESA-N |
| XLogP | 1.56 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.15 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|