C6HF11 — CID 141179739
4-(difluoromethyl)-1,1,1,2,3,4,5,5,5-nonafluoropent-2-ene (PubChem CID 141179739) has the molecular formula C6HF11 and a molecular weight of 282.05 g/mol. Its IUPAC name is 4-(difluoromethyl)-1,1,1,2,3,4,5,5,5-nonafluoropent-2-ene.
| Compound Name | 4-(difluoromethyl)-1,1,1,2,3,4,5,5,5-nonafluoropent-2-ene |
|---|---|
| PubChem CID | 141179739 |
| Molecular Formula | C6HF11 |
| Molecular Weight | 282.05 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | 4-(difluoromethyl)-1,1,1,2,3,4,5,5,5-nonafluoropent-2-ene |
| SMILES | FC(=C(F)C(F)(C(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6HF11/c7-1(2(8)5(12,13)14)4(11,3(9)10)6(15,16)17/h3H |
| InChIKey | CZFSIRNYBAOTHN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.05 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |