C18H19N3O2 — CID 141182200
2,4,5-triazatricyclo[14.2.2.16,10]henicosa-1(19),6,8,10(21),16(20),17-hexaene-3,12-dione (PubChem CID 141182200) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 2,4,5-triazatricyclo[14.2.2.16,10]henicosa-1(19),6,8,10(21),16(20),17-hexaene-3,12-dione.
| Compound Name | 2,4,5-triazatricyclo[14.2.2.16,10]henicosa-1(19),6,8,10(21),16(20),17-hexaene-3,12-dione |
|---|---|
| PubChem CID | 141182200 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2,4,5-triazatricyclo[14.2.2.16,10]henicosa-1(19),6,8,10(21),16(20),17-hexaene-3,12-dione |
| SMILES | O=C1CCCc2ccc(cc2)NC(=O)NNc2cccc(c2)C1 |
| InChI | InChI=1S/C18H19N3O2/c22-17-6-2-3-13-7-9-15(10-8-13)19-18(23)21-20-16-5-1-4-14(11-16)12-17/h1,4-5,7-11,20H,2-3,6,12H2,(H2,19,21,23) |
| InChIKey | POJMXOZKTREFOZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |