C19H22N2O — CID 141182213
4,11-diazatricyclo[14.2.2.16,10]henicosa-1(19),6(21),7,9,16(20),17-hexaen-2-one (PubChem CID 141182213) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is 4,11-diazatricyclo[14.2.2.16,10]henicosa-1(19),6(21),7,9,16(20),17-hexaen-2-one.
| Compound Name | 4,11-diazatricyclo[14.2.2.16,10]henicosa-1(19),6(21),7,9,16(20),17-hexaen-2-one |
|---|---|
| PubChem CID | 141182213 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 4,11-diazatricyclo[14.2.2.16,10]henicosa-1(19),6(21),7,9,16(20),17-hexaen-2-one |
| SMILES | O=C1CNCc2cccc(c2)NCCCCc2ccc1cc2 |
| InChI | InChI=1S/C19H22N2O/c22-19-14-20-13-16-5-3-6-18(12-16)21-11-2-1-4-15-7-9-17(19)10-8-15/h3,5-10,12,20-21H,1-2,4,11,13-14H2 |
| InChIKey | HASGGJRSSLBIDG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |