C20H24N4O5S2 — CID 141182671
ethyl 2-[2-(benzoylcarbamothioylamino)-1,3-thiazol-4-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 141182671) has the molecular formula C20H24N4O5S2 and a molecular weight of 464.57 g/mol. Its IUPAC name is ethyl 2-[2-(benzoylcarbamothioylamino)-1,3-thiazol-4-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | ethyl 2-[2-(benzoylcarbamothioylamino)-1,3-thiazol-4-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 141182671 |
| Molecular Formula | C20H24N4O5S2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | ethyl 2-[2-(benzoylcarbamothioylamino)-1,3-thiazol-4-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | CCOC(=O)C(NC(=O)OC(C)(C)C)c1csc(NC(=S)NC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C20H24N4O5S2/c1-5-28-16(26)14(22-19(27)29-20(2,3)4)13-11-31-18(21-13)24-17(30)23-15(25)12-9-7-6-8-10-12/h6-11,14H,5H2,1-4H3,(H,22,27)(H2,21,23,24,25,30) |
| InChIKey | BPFSIHAAYWIKOZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|