C17H15N5O2S3 — CID 54571870
N-[[4-[2-(acetamidomethyl)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]carbamothioyl]benzamide (PubChem CID 54571870) has the molecular formula C17H15N5O2S3 and a molecular weight of 417.54 g/mol. Its IUPAC name is N-[[4-[2-(acetamidomethyl)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]carbamothioyl]benzamide.
| Compound Name | N-[[4-[2-(acetamidomethyl)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 54571870 |
| Molecular Formula | C17H15N5O2S3 |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | N-[[4-[2-(acetamidomethyl)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]carbamothioyl]benzamide |
| SMILES | CC(=O)NCc1nc(-c2csc(NC(=S)NC(=O)c3ccccc3)n2)cs1 |
| InChI | InChI=1S/C17H15N5O2S3/c1-10(23)18-7-14-19-12(8-26-14)13-9-27-17(20-13)22-16(25)21-15(24)11-5-3-2-4-6-11/h2-6,8-9H,7H2,1H3,(H,18,23)(H2,20,21,22,24,25) |
| InChIKey | ZXWHWRPXCYSJJI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|