C20H18N4O2S2 — CID 174335205
N-[[4-(2-acetamido-6-methylphenyl)-1,3-thiazol-2-yl]carbamothioyl]benzamide (PubChem CID 174335205) has the molecular formula C20H18N4O2S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-[[4-(2-acetamido-6-methylphenyl)-1,3-thiazol-2-yl]carbamothioyl]benzamide.
| Compound Name | N-[[4-(2-acetamido-6-methylphenyl)-1,3-thiazol-2-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 174335205 |
| Molecular Formula | C20H18N4O2S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | N-[[4-(2-acetamido-6-methylphenyl)-1,3-thiazol-2-yl]carbamothioyl]benzamide |
| SMILES | CC(=O)Nc1cccc(C)c1-c1csc(NC(=S)NC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C20H18N4O2S2/c1-12-7-6-10-15(21-13(2)25)17(12)16-11-28-20(22-16)24-19(27)23-18(26)14-8-4-3-5-9-14/h3-11H,1-2H3,(H,21,25)(H2,22,23,24,26,27) |
| InChIKey | ZDHKTCCFMKXKPX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|