C17H12ClF2NO2 — CID 141183976
3-(4-chlorophenyl)prop-2-ynyl-[(3,4-difluorophenyl)methyl]carbamic acid (PubChem CID 141183976) has the molecular formula C17H12ClF2NO2 and a molecular weight of 335.74 g/mol. Its IUPAC name is 3-(4-chlorophenyl)prop-2-ynyl-[(3,4-difluorophenyl)methyl]carbamic acid.
| Compound Name | 3-(4-chlorophenyl)prop-2-ynyl-[(3,4-difluorophenyl)methyl]carbamic acid |
|---|---|
| PubChem CID | 141183976 |
| Molecular Formula | C17H12ClF2NO2 |
| Molecular Weight | 335.74 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 3-(4-chlorophenyl)prop-2-ynyl-[(3,4-difluorophenyl)methyl]carbamic acid |
| SMILES | O=C(O)N(CC#Cc1ccc(Cl)cc1)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H12ClF2NO2/c18-14-6-3-12(4-7-14)2-1-9-21(17(22)23)11-13-5-8-15(19)16(20)10-13/h3-8,10H,9,11H2,(H,22,23) |
| InChIKey | XWXPMYQLUOFLRR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.74 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|