C24H41NaO6 — CID 141192447
sodium (Z)-2-hydroxy-2-(2-hydroxypropanoyl)-4-oxohenicos-12-enoate (PubChem CID 141192447) has the molecular formula C24H41NaO6 and a molecular weight of 448.58 g/mol. Its IUPAC name is sodium (Z)-2-hydroxy-2-(2-hydroxypropanoyl)-4-oxohenicos-12-enoate.
| Compound Name | sodium (Z)-2-hydroxy-2-(2-hydroxypropanoyl)-4-oxohenicos-12-enoate |
|---|---|
| PubChem CID | 141192447 |
| Molecular Formula | C24H41NaO6 |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | sodium (Z)-2-hydroxy-2-(2-hydroxypropanoyl)-4-oxohenicos-12-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)CC(O)(C(=O)[O-])C(=O)C(C)O.[Na+] |
| InChI | InChI=1S/C24H42O6.Na/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(26)19-24(30,23(28)29)22(27)20(2)25;/h10-11,20,25,30H,3-9,12-19H2,1-2H3,(H,28,29);/q;+1/p-1/b11-10-; |
| InChIKey | MKFSQVRHHYUQHZ-GMFCBQQYSA-M |
| XLogP | 0.42 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|