C10H4Br2I2 — CID 141193260
1,2-dibromo-4,8-diiodonaphthalene (PubChem CID 141193260) has the molecular formula C10H4Br2I2 and a molecular weight of 537.76 g/mol. Its IUPAC name is 1,2-dibromo-4,8-diiodonaphthalene.
| Compound Name | 1,2-dibromo-4,8-diiodonaphthalene |
|---|---|
| PubChem CID | 141193260 |
| Molecular Formula | C10H4Br2I2 |
| Molecular Weight | 537.76 g/mol |
| Exact Mass | 535.68 |
| IUPAC Name | 1,2-dibromo-4,8-diiodonaphthalene |
| SMILES | Brc1cc(I)c2cccc(I)c2c1Br |
| InChI | InChI=1S/C10H4Br2I2/c11-6-4-8(14)5-2-1-3-7(13)9(5)10(6)12/h1-4H |
| InChIKey | SJHIFGXCIFWUEP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.76 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|