C17H15F3N2OS — CID 141193519
4-[5-[6-(trifluoromethyl)-1H-indol-4-yl]thiophen-3-yl]morpholine (PubChem CID 141193519) has the molecular formula C17H15F3N2OS and a molecular weight of 352.38 g/mol. Its IUPAC name is 4-[5-[6-(trifluoromethyl)-1H-indol-4-yl]thiophen-3-yl]morpholine.
| Compound Name | 4-[5-[6-(trifluoromethyl)-1H-indol-4-yl]thiophen-3-yl]morpholine |
|---|---|
| PubChem CID | 141193519 |
| Molecular Formula | C17H15F3N2OS |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 4-[5-[6-(trifluoromethyl)-1H-indol-4-yl]thiophen-3-yl]morpholine |
| SMILES | FC(F)(F)c1cc(-c2cc(N3CCOCC3)cs2)c2cc[nH]c2c1 |
| InChI | InChI=1S/C17H15F3N2OS/c18-17(19,20)11-7-14(13-1-2-21-15(13)8-11)16-9-12(10-24-16)22-3-5-23-6-4-22/h1-2,7-10,21H,3-6H2 |
| InChIKey | FITPVHSONKOKAS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |