C16H18N2OS — CID 141274171
4-[5-(2,3-dihydro-1H-indol-4-yl)thiophen-3-yl]morpholine (PubChem CID 141274171) has the molecular formula C16H18N2OS and a molecular weight of 286.40 g/mol. Its IUPAC name is 4-[5-(2,3-dihydro-1H-indol-4-yl)thiophen-3-yl]morpholine.
| Compound Name | 4-[5-(2,3-dihydro-1H-indol-4-yl)thiophen-3-yl]morpholine |
|---|---|
| PubChem CID | 141274171 |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 4-[5-(2,3-dihydro-1H-indol-4-yl)thiophen-3-yl]morpholine |
| SMILES | c1cc2c(c(-c3cc(N4CCOCC4)cs3)c1)CCN2 |
| InChI | InChI=1S/C16H18N2OS/c1-2-14(13-4-5-17-15(13)3-1)16-10-12(11-20-16)18-6-8-19-9-7-18/h1-3,10-11,17H,4-9H2 |
| InChIKey | MAWAJFBGMUVQOJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |