C15H18F3NO2 — CID 141200482
2-[2-propyl-6-(trifluoromethyl)-3-pyridinyl]hex-2-enoic acid (PubChem CID 141200482) has the molecular formula C15H18F3NO2 and a molecular weight of 301.31 g/mol. Its IUPAC name is 2-[2-propyl-6-(trifluoromethyl)-3-pyridinyl]hex-2-enoic acid.
| Compound Name | 2-[2-propyl-6-(trifluoromethyl)-3-pyridinyl]hex-2-enoic acid |
|---|---|
| PubChem CID | 141200482 |
| Molecular Formula | C15H18F3NO2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-[2-propyl-6-(trifluoromethyl)-3-pyridinyl]hex-2-enoic acid |
| SMILES | CCCC=C(C(=O)O)c1ccc(C(F)(F)F)nc1CCC |
| InChI | InChI=1S/C15H18F3NO2/c1-3-5-7-11(14(20)21)10-8-9-13(15(16,17)18)19-12(10)6-4-2/h7-9H,3-6H2,1-2H3,(H,20,21) |
| InChIKey | PTFKKKRUAHJUTL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|