C22H26 — CID 141201037
7-ethenyl-6-ethynyl-6-(2-methylprop-1-enyl)-7-prop-1-enylundec-8-en-2,4-diyne (PubChem CID 141201037) has the molecular formula C22H26 and a molecular weight of 290.45 g/mol. Its IUPAC name is 7-ethenyl-6-ethynyl-6-(2-methylprop-1-enyl)-7-prop-1-enylundec-8-en-2,4-diyne.
| Compound Name | 7-ethenyl-6-ethynyl-6-(2-methylprop-1-enyl)-7-prop-1-enylundec-8-en-2,4-diyne |
|---|---|
| PubChem CID | 141201037 |
| Molecular Formula | C22H26 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 7-ethenyl-6-ethynyl-6-(2-methylprop-1-enyl)-7-prop-1-enylundec-8-en-2,4-diyne |
| SMILES | C#CC(C#CC#CC)(C=C(C)C)C(C=C)(C=CC)C=CCC |
| InChI | InChI=1S/C22H26/c1-8-13-15-18-22(12-5,19-20(6)7)21(11-4,16-10-3)17-14-9-2/h5,10-11,14,16-17,19H,4,9H2,1-3,6-7H3 |
| InChIKey | ZFCSQZXDIJLPGJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|