About 5-cyclopropyl-6-methyl-3,4-diazatricyclo[6.2.1.02,7]undecane
5-cyclopropyl-6-methyl-3,4-diazatricyclo[6.2.1.02,7]undecane (PubChem CID 141201205) has the molecular formula C13H22N2
and a molecular weight of 206.33 g/mol. Its IUPAC name is 5-cyclopropyl-6-methyl-3,4-diazatricyclo[6.2.1.02,7]undecane.
Analyze 5-cyclopropyl-6-methyl-3,4-diazatricyclo[6.2.1.02,7]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-6-methyl-3,4-diazatricyclo[6.2.1.02,7]undecane?
The IUPAC name of 5-cyclopropyl-6-methyl-3,4-diazatricyclo[6.2.1.02,7]undecane (CID 141201205) is 5-cyclopropyl-6-methyl-3,4-diazatricyclo[6.2.1.02,7]undecane.
What is the SMILES notation for 5-cyclopropyl-6-methyl-3,4-diazatricyclo[6.2.1.02,7]undecane?
The canonical SMILES for 5-cyclopropyl-6-methyl-3,4-diazatricyclo[6.2.1.02,7]undecane is CC1C(C2CC2)NNC2C3CCC(C3)C12.
What is the InChIKey of 5-cyclopropyl-6-methyl-3,4-diazatricyclo[6.2.1.02,7]undecane?
The InChIKey is LSGYCFLUHLWMDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2/c1-7-11-9-4-5-10(6-9)13(11)15-14-12(7)8-2-3-8/h7-15H,2-6H2,1H3.
What are the key properties of 5-cyclopropyl-6-methyl-3,4-diazatricyclo[6.2.1.02,7]undecane?
5-cyclopropyl-6-methyl-3,4-diazatricyclo[6.2.1.02,7]undecane has a molecular weight of 206.33 g/mol, XLogP of 1.92, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-6-methyl-3,4-diazatricyclo[6.2.1.02,7]undecane is sourced from PubChem (CID 141201205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).