C14H11FO — CID 141212503
1-fluoro-4,6-dimethyldibenzofuran (PubChem CID 141212503) has the molecular formula C14H11FO and a molecular weight of 214.24 g/mol. Its IUPAC name is 1-fluoro-4,6-dimethyldibenzofuran.
| Compound Name | 1-fluoro-4,6-dimethyldibenzofuran |
|---|---|
| PubChem CID | 141212503 |
| Molecular Formula | C14H11FO |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 1-fluoro-4,6-dimethyldibenzofuran |
| SMILES | Cc1cccc2c1oc1c(C)ccc(F)c12 |
| InChI | InChI=1S/C14H11FO/c1-8-4-3-5-10-12-11(15)7-6-9(2)14(12)16-13(8)10/h3-7H,1-2H3 |
| InChIKey | BFYQEJOKFIZOMF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |