About 1-fluoro-4,6-dimethyldibenzofuran
1-fluoro-4,6-dimethyldibenzofuran (PubChem CID 141212503) has the molecular formula C14H11FO
and a molecular weight of 214.24 g/mol. Its IUPAC name is 1-fluoro-4,6-dimethyldibenzofuran.
Molecular Properties
| Compound Name | 1-fluoro-4,6-dimethyldibenzofuran |
| PubChem CID | 141212503 |
| Molecular Formula | C14H11FO |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 1-fluoro-4,6-dimethyldibenzofuran |
| SMILES | Cc1cccc2c1oc1c(C)ccc(F)c12 |
| InChI | InChI=1S/C14H11FO/c1-8-4-3-5-10-12-11(15)7-6-9(2)14(12)16-13(8)10/h3-7H,1-2H3 |
| InChIKey | BFYQEJOKFIZOMF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-fluoro-4,6-dimethyldibenzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-4,6-dimethyldibenzofuran?
The IUPAC name of 1-fluoro-4,6-dimethyldibenzofuran (CID 141212503) is 1-fluoro-4,6-dimethyldibenzofuran.
What is the SMILES notation for 1-fluoro-4,6-dimethyldibenzofuran?
The canonical SMILES for 1-fluoro-4,6-dimethyldibenzofuran is Cc1cccc2c1oc1c(C)ccc(F)c12.
What is the InChIKey of 1-fluoro-4,6-dimethyldibenzofuran?
The InChIKey is BFYQEJOKFIZOMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11FO/c1-8-4-3-5-10-12-11(15)7-6-9(2)14(12)16-13(8)10/h3-7H,1-2H3.
What are the key properties of 1-fluoro-4,6-dimethyldibenzofuran?
1-fluoro-4,6-dimethyldibenzofuran has a molecular weight of 214.24 g/mol, XLogP of 4.34, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4,6-dimethyldibenzofuran is sourced from PubChem (CID 141212503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).