C13H22N2O4 — CID 141221354
3-hydroxypropyl (E)-6-amino-4-carbamoyl-2-methylideneoct-3-enoate (PubChem CID 141221354) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is 3-hydroxypropyl (E)-6-amino-4-carbamoyl-2-methylideneoct-3-enoate.
| Compound Name | 3-hydroxypropyl (E)-6-amino-4-carbamoyl-2-methylideneoct-3-enoate |
|---|---|
| PubChem CID | 141221354 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 3-hydroxypropyl (E)-6-amino-4-carbamoyl-2-methylideneoct-3-enoate |
| SMILES | C=C(/C=C(\CC(N)CC)C(N)=O)C(=O)OCCCO |
| InChI | InChI=1S/C13H22N2O4/c1-3-11(14)8-10(12(15)17)7-9(2)13(18)19-6-4-5-16/h7,11,16H,2-6,8,14H2,1H3,(H2,15,17)/b10-7+ |
| InChIKey | DGXOUJLTLRKXPU-JXMROGBWSA-N |
| XLogP | 0.01 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|