C12H21N3O8 — CID 141228215
(3S)-3-amino-4-[(3R,4R,5S,6R)-3-[(2-deuterioacetyl)amino]-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4-oxobutanamide (PubChem CID 141228215) has the molecular formula C12H21N3O8 and a molecular weight of 336.32 g/mol. Its IUPAC name is (3S)-3-amino-4-[(3R,4R,5S,6R)-3-[(2-deuterioacetyl)amino]-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4-oxobutanamide.
| Compound Name | (3S)-3-amino-4-[(3R,4R,5S,6R)-3-[(2-deuterioacetyl)amino]-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4-oxobutanamide |
|---|---|
| PubChem CID | 141228215 |
| Molecular Formula | C12H21N3O8 |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (3S)-3-amino-4-[(3R,4R,5S,6R)-3-[(2-deuterioacetyl)amino]-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4-oxobutanamide |
| SMILES | [2H]CC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)OC1(O)C(=O)[C@@H](N)CC(N)=O |
| InChI | InChI=1S/C12H21N3O8/c1-4(17)15-10-9(20)8(19)6(3-16)23-12(10,22)11(21)5(13)2-7(14)18/h5-6,8-10,16,19-20,22H,2-3,13H2,1H3,(H2,14,18)(H,15,17)/t5-,6+,8+,9-,10+,12?/m0/s1/i1D |
| InChIKey | KOEDKYUCVJMCBF-MRPNVFAXSA-N |
| XLogP | -4.94 |
| TPSA | 205.43 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | -4.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |