C10H16NNa2O10P — CID 169038087
disodium;[(2R,3S,4R,5R)-6-acetyl-5-[(2-deuterioacetyl)amino]-3,4,6-trihydroxyoxan-2-yl]methyl phosphate (PubChem CID 169038087) has the molecular formula C10H16NNa2O10P and a molecular weight of 388.20 g/mol. Its IUPAC name is disodium;[(2R,3S,4R,5R)-6-acetyl-5-[(2-deuterioacetyl)amino]-3,4,6-trihydroxyoxan-2-yl]methyl phosphate.
| Compound Name | disodium;[(2R,3S,4R,5R)-6-acetyl-5-[(2-deuterioacetyl)amino]-3,4,6-trihydroxyoxan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 169038087 |
| Molecular Formula | C10H16NNa2O10P |
| Molecular Weight | 388.20 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | disodium;[(2R,3S,4R,5R)-6-acetyl-5-[(2-deuterioacetyl)amino]-3,4,6-trihydroxyoxan-2-yl]methyl phosphate |
| SMILES | [2H]CC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](COP(=O)([O-])[O-])OC1(O)C(C)=O.[Na+].[Na+] |
| InChI | InChI=1S/C10H18NO10P.2Na/c1-4(12)10(16)9(11-5(2)13)8(15)7(14)6(21-10)3-20-22(17,18)19;;/h6-9,14-16H,3H2,1-2H3,(H,11,13)(H2,17,18,19);;/q;2*+1/p-2/t6-,7-,8+,9-,10?;;/m1../s1/i2D;; |
| InChIKey | MIYBNABWIFKPGI-LCPRYVJVSA-L |
| XLogP | -10.26 |
| TPSA | 188.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.20 |
| LogP ≤ 5 | -10.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|