C7H13N2O8P-2 — CID 3490
[5-[(2-aminoacetyl)amino]-3,4-dihydroxyoxolan-2-yl]methyl phosphate (PubChem CID 3490) has the molecular formula C7H13N2O8P-2 and a molecular weight of 284.16 g/mol. Its IUPAC name is [5-[(2-aminoacetyl)amino]-3,4-dihydroxyoxolan-2-yl]methyl phosphate.
| Compound Name | [5-[(2-aminoacetyl)amino]-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 3490 |
| Molecular Formula | C7H13N2O8P-2 |
| Molecular Weight | 284.16 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | [5-[(2-aminoacetyl)amino]-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
| SMILES | NCC(=O)NC1OC(COP(=O)([O-])[O-])C(O)C1O |
| InChI | InChI=1S/C7H15N2O8P/c8-1-4(10)9-7-6(12)5(11)3(17-7)2-16-18(13,14)15/h3,5-7,11-12H,1-2,8H2,(H,9,10)(H2,13,14,15)/p-2 |
| InChIKey | OBQMLSFOUZUIOB-UHFFFAOYSA-L |
| XLogP | -4.65 |
| TPSA | 177.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.16 |
| LogP ≤ 5 | -4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|