C18H22F15NO5 — CID 141229821
tert-butyl N-[1-hydroxy-3-[2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)ethoxy]propan-2-yl]carbamate (PubChem CID 141229821) has the molecular formula C18H22F15NO5 and a molecular weight of 617.35 g/mol. Its IUPAC name is tert-butyl N-[1-hydroxy-3-[2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)ethoxy]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-hydroxy-3-[2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)ethoxy]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 141229821 |
| Molecular Formula | C18H22F15NO5 |
| Molecular Weight | 617.35 g/mol |
| Exact Mass | 617.13 |
| IUPAC Name | tert-butyl N-[1-hydroxy-3-[2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)ethoxy]propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CO)COCCOCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H22F15NO5/c1-11(2,3)39-10(36)34-9(6-35)7-37-4-5-38-8-12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)17(29,30)18(31,32)33/h9,35H,4-8H2,1-3H3,(H,34,36) |
| InChIKey | KUKAMIXAGATLTN-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.35 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|