C8H21N3O2S — CID 141231013
1-amino-3,3-dimethyl-5-[methyl(sulfamoyl)amino]pentane (PubChem CID 141231013) has the molecular formula C8H21N3O2S and a molecular weight of 223.34 g/mol. Its IUPAC name is 1-amino-3,3-dimethyl-5-[methyl(sulfamoyl)amino]pentane.
| Compound Name | 1-amino-3,3-dimethyl-5-[methyl(sulfamoyl)amino]pentane |
|---|---|
| PubChem CID | 141231013 |
| Molecular Formula | C8H21N3O2S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 1-amino-3,3-dimethyl-5-[methyl(sulfamoyl)amino]pentane |
| SMILES | CN(CCC(C)(C)CCN)S(N)(=O)=O |
| InChI | InChI=1S/C8H21N3O2S/c1-8(2,4-6-9)5-7-11(3)14(10,12)13/h4-7,9H2,1-3H3,(H2,10,12,13) |
| InChIKey | URSULEGSFSQLHX-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |