C42H63O10P — CID 141231281
tris[2,4-bis(4-hydroxybutyl)phenyl] phosphate (PubChem CID 141231281) has the molecular formula C42H63O10P and a molecular weight of 758.93 g/mol. Its IUPAC name is tris[2,4-bis(4-hydroxybutyl)phenyl] phosphate.
| Compound Name | tris[2,4-bis(4-hydroxybutyl)phenyl] phosphate |
|---|---|
| PubChem CID | 141231281 |
| Molecular Formula | C42H63O10P |
| Molecular Weight | 758.93 g/mol |
| Exact Mass | 758.42 |
| IUPAC Name | tris[2,4-bis(4-hydroxybutyl)phenyl] phosphate |
| SMILES | O=P(Oc1ccc(CCCCO)cc1CCCCO)(Oc1ccc(CCCCO)cc1CCCCO)Oc1ccc(CCCCO)cc1CCCCO |
| InChI | InChI=1S/C42H63O10P/c43-25-7-1-13-34-19-22-40(37(31-34)16-4-10-28-46)50-53(49,51-41-23-20-35(14-2-8-26-44)32-38(41)17-5-11-29-47)52-42-24-21-36(15-3-9-27-45)33-39(42)18-6-12-30-48/h19-24,31-33,43-48H,1-18,25-30H2 |
| InChIKey | OBRDGHKIGPWFLI-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 166.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.93 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|