C28H32F2N6O5 — CID 141232646
N-[(2S)-2-[acetyl-[(2,3-difluorophenyl)methylamino]amino]-5-oxo-5-piperazin-1-ylpentoxy]-N-(5-phenyl-1,2-oxazol-3-yl)formamide (PubChem CID 141232646) has the molecular formula C28H32F2N6O5 and a molecular weight of 570.60 g/mol. Its IUPAC name is N-[(2S)-2-[acetyl-[(2,3-difluorophenyl)methylamino]amino]-5-oxo-5-piperazin-1-ylpentoxy]-N-(5-phenyl-1,2-oxazol-3-yl)formamide.
| Compound Name | N-[(2S)-2-[acetyl-[(2,3-difluorophenyl)methylamino]amino]-5-oxo-5-piperazin-1-ylpentoxy]-N-(5-phenyl-1,2-oxazol-3-yl)formamide |
|---|---|
| PubChem CID | 141232646 |
| Molecular Formula | C28H32F2N6O5 |
| Molecular Weight | 570.60 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | N-[(2S)-2-[acetyl-[(2,3-difluorophenyl)methylamino]amino]-5-oxo-5-piperazin-1-ylpentoxy]-N-(5-phenyl-1,2-oxazol-3-yl)formamide |
| SMILES | CC(=O)N(NCc1cccc(F)c1F)[C@@H](CCC(=O)N1CCNCC1)CON(C=O)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C28H32F2N6O5/c1-20(38)36(32-17-22-8-5-9-24(29)28(22)30)23(10-11-27(39)34-14-12-31-13-15-34)18-40-35(19-37)26-16-25(41-33-26)21-6-3-2-4-7-21/h2-9,16,19,23,31-32H,10-15,17-18H2,1H3/t23-/m0/s1 |
| InChIKey | ROWRKOIPPAKCFZ-QHCPKHFHSA-N |
| XLogP | 2.65 |
| TPSA | 120.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.60 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|