C28H32ClFN6O4 — CID 141232649
N-[(2R)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-oxo-5-piperazin-1-ylpentoxy]-N-isoquinolin-3-ylformamide (PubChem CID 141232649) has the molecular formula C28H32ClFN6O4 and a molecular weight of 571.05 g/mol. Its IUPAC name is N-[(2R)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-oxo-5-piperazin-1-ylpentoxy]-N-isoquinolin-3-ylformamide.
| Compound Name | N-[(2R)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-oxo-5-piperazin-1-ylpentoxy]-N-isoquinolin-3-ylformamide |
|---|---|
| PubChem CID | 141232649 |
| Molecular Formula | C28H32ClFN6O4 |
| Molecular Weight | 571.05 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | N-[(2R)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-oxo-5-piperazin-1-ylpentoxy]-N-isoquinolin-3-ylformamide |
| SMILES | CC(=O)N(NCc1cccc(F)c1Cl)[C@H](CCC(=O)N1CCNCC1)CON(C=O)c1cc2ccccc2cn1 |
| InChI | InChI=1S/C28H32ClFN6O4/c1-20(38)36(33-17-23-7-4-8-25(30)28(23)29)24(9-10-27(39)34-13-11-31-12-14-34)18-40-35(19-37)26-15-21-5-2-3-6-22(21)16-32-26/h2-8,15-16,19,24,31,33H,9-14,17-18H2,1H3/t24-/m1/s1 |
| InChIKey | VVMWRCMZSQCANF-XMMPIXPASA-N |
| XLogP | 3.06 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.05 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|