C29H35ClF2N6O7S — CID 87078953
tert-butyl N-[[(4S)-4-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-[(6-fluoroisoquinolin-3-yl)-formylamino]oxypentyl]sulfamoyl]carbamate (PubChem CID 87078953) has the molecular formula C29H35ClF2N6O7S and a molecular weight of 685.15 g/mol. Its IUPAC name is tert-butyl N-[[(4S)-4-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-[(6-fluoroisoquinolin-3-yl)-formylamino]oxypentyl]sulfamoyl]carbamate.
| Compound Name | tert-butyl N-[[(4S)-4-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-[(6-fluoroisoquinolin-3-yl)-formylamino]oxypentyl]sulfamoyl]carbamate |
|---|---|
| PubChem CID | 87078953 |
| Molecular Formula | C29H35ClF2N6O7S |
| Molecular Weight | 685.15 g/mol |
| Exact Mass | 684.19 |
| IUPAC Name | tert-butyl N-[[(4S)-4-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-[(6-fluoroisoquinolin-3-yl)-formylamino]oxypentyl]sulfamoyl]carbamate |
| SMILES | CC(=O)N(NCc1cccc(F)c1Cl)[C@@H](CCCNS(=O)(=O)NC(=O)OC(C)(C)C)CON(C=O)c1cc2cc(F)ccc2cn1 |
| InChI | InChI=1S/C29H35ClF2N6O7S/c1-19(40)38(34-16-21-7-5-9-25(32)27(21)30)24(8-6-12-35-46(42,43)36-28(41)45-29(2,3)4)17-44-37(18-39)26-14-22-13-23(31)11-10-20(22)15-33-26/h5,7,9-11,13-15,18,24,34-35H,6,8,12,16-17H2,1-4H3,(H,36,41)/t24-/m0/s1 |
| InChIKey | RFSCMJLHKLKUKS-DEOSSOPVSA-N |
| XLogP | 4.12 |
| TPSA | 159.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.15 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|