C26H29ClF2N4O4 — CID 87078561
N-[(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-hydroxy-4,4-dimethylpentoxy]-N-(6-fluoroisoquinolin-3-yl)formamide (PubChem CID 87078561) has the molecular formula C26H29ClF2N4O4 and a molecular weight of 534.99 g/mol. Its IUPAC name is N-[(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-hydroxy-4,4-dimethylpentoxy]-N-(6-fluoroisoquinolin-3-yl)formamide.
| Compound Name | N-[(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-hydroxy-4,4-dimethylpentoxy]-N-(6-fluoroisoquinolin-3-yl)formamide |
|---|---|
| PubChem CID | 87078561 |
| Molecular Formula | C26H29ClF2N4O4 |
| Molecular Weight | 534.99 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | N-[(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-hydroxy-4,4-dimethylpentoxy]-N-(6-fluoroisoquinolin-3-yl)formamide |
| SMILES | CC(=O)N(NCc1cccc(F)c1Cl)[C@H](CON(C=O)c1cc2cc(F)ccc2cn1)CC(C)(C)CO |
| InChI | InChI=1S/C26H29ClF2N4O4/c1-17(36)33(31-13-19-5-4-6-23(29)25(19)27)22(11-26(2,3)15-34)14-37-32(16-35)24-10-20-9-21(28)8-7-18(20)12-30-24/h4-10,12,16,22,31,34H,11,13-15H2,1-3H3/t22-/m0/s1 |
| InChIKey | SBEBOJZPZOFNPS-QFIPXVFZSA-N |
| XLogP | 4.39 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.99 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|