C26H31ClFN5O5 — CID 87078475
N-[(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-3-[bis(2-hydroxyethyl)amino]propoxy]-N-isoquinolin-3-ylformamide (PubChem CID 87078475) has the molecular formula C26H31ClFN5O5 and a molecular weight of 548.02 g/mol. Its IUPAC name is N-[(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-3-[bis(2-hydroxyethyl)amino]propoxy]-N-isoquinolin-3-ylformamide.
| Compound Name | N-[(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-3-[bis(2-hydroxyethyl)amino]propoxy]-N-isoquinolin-3-ylformamide |
|---|---|
| PubChem CID | 87078475 |
| Molecular Formula | C26H31ClFN5O5 |
| Molecular Weight | 548.02 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | N-[(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-3-[bis(2-hydroxyethyl)amino]propoxy]-N-isoquinolin-3-ylformamide |
| SMILES | CC(=O)N(NCc1cccc(F)c1Cl)[C@H](CON(C=O)c1cc2ccccc2cn1)CN(CCO)CCO |
| InChI | InChI=1S/C26H31ClFN5O5/c1-19(37)33(30-15-22-7-4-8-24(28)26(22)27)23(16-31(9-11-34)10-12-35)17-38-32(18-36)25-13-20-5-2-3-6-21(20)14-29-25/h2-8,13-14,18,23,30,34-35H,9-12,15-17H2,1H3/t23-/m0/s1 |
| InChIKey | ONJBXNACNJMWBD-QHCPKHFHSA-N |
| XLogP | 2.13 |
| TPSA | 118.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.02 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|