C24H28ClFN4O4 — CID 90759231
N-[(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-hydroxypentoxy]-1H-isoquinoline-2-carboxamide (PubChem CID 90759231) has the molecular formula C24H28ClFN4O4 and a molecular weight of 490.96 g/mol. Its IUPAC name is N-[(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-hydroxypentoxy]-1H-isoquinoline-2-carboxamide.
| Compound Name | N-[(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-hydroxypentoxy]-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 90759231 |
| Molecular Formula | C24H28ClFN4O4 |
| Molecular Weight | 490.96 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | N-[(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-hydroxypentoxy]-1H-isoquinoline-2-carboxamide |
| SMILES | CC(=O)N(NCc1cccc(F)c1Cl)[C@@H](CCCO)CONC(=O)N1C=Cc2ccccc2C1 |
| InChI | InChI=1S/C24H28ClFN4O4/c1-17(32)30(27-14-19-8-4-10-22(26)23(19)25)21(9-5-13-31)16-34-28-24(33)29-12-11-18-6-2-3-7-20(18)15-29/h2-4,6-8,10-12,21,27,31H,5,9,13-16H2,1H3,(H,28,33)/t21-/m0/s1 |
| InChIKey | ZNIJIZDSWHPPFU-NRFANRHFSA-N |
| XLogP | 3.60 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.96 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|