C31H38ClFN6O5 — CID 91366451
N-[(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)-5-oxopentoxy]-1H-isoquinoline-2-carboxamide (PubChem CID 91366451) has the molecular formula C31H38ClFN6O5 and a molecular weight of 629.13 g/mol. Its IUPAC name is N-[(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)-5-oxopentoxy]-1H-isoquinoline-2-carboxamide.
| Compound Name | N-[(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)-5-oxopentoxy]-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 91366451 |
| Molecular Formula | C31H38ClFN6O5 |
| Molecular Weight | 629.13 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | N-[(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)-5-oxopentoxy]-1H-isoquinoline-2-carboxamide |
| SMILES | CC(=O)N(NCc1cccc(F)c1Cl)[C@@H](CCC(=O)N1CCN2CCOCC2C1)CONC(=O)N1C=Cc2ccccc2C1 |
| InChI | InChI=1S/C31H38ClFN6O5/c1-22(40)39(34-17-24-7-4-8-28(33)30(24)32)26(9-10-29(41)37-14-13-36-15-16-43-20-27(36)19-37)21-44-35-31(42)38-12-11-23-5-2-3-6-25(23)18-38/h2-8,11-12,26-27,34H,9-10,13-21H2,1H3,(H,35,42)/t26-,27?/m0/s1 |
| InChIKey | AHFTUNYBLMZIDJ-QBHOUYDASA-N |
| XLogP | 3.15 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.13 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|