C24H28ClFN4O5 — CID 90730711
N-[(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-4,5-dihydroxypentoxy]-1H-isoquinoline-2-carboxamide (PubChem CID 90730711) has the molecular formula C24H28ClFN4O5 and a molecular weight of 506.96 g/mol. Its IUPAC name is N-[(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-4,5-dihydroxypentoxy]-1H-isoquinoline-2-carboxamide.
| Compound Name | N-[(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-4,5-dihydroxypentoxy]-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 90730711 |
| Molecular Formula | C24H28ClFN4O5 |
| Molecular Weight | 506.96 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | N-[(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-4,5-dihydroxypentoxy]-1H-isoquinoline-2-carboxamide |
| SMILES | CC(=O)N(NCc1cccc(F)c1Cl)[C@H](CONC(=O)N1C=Cc2ccccc2C1)CC(O)CO |
| InChI | InChI=1S/C24H28ClFN4O5/c1-16(32)30(27-12-18-7-4-8-22(26)23(18)25)20(11-21(33)14-31)15-35-28-24(34)29-10-9-17-5-2-3-6-19(17)13-29/h2-10,20-21,27,31,33H,11-15H2,1H3,(H,28,34)/t20-,21?/m0/s1 |
| InChIKey | KAKJZFKPACKLAN-BGERDNNASA-N |
| XLogP | 2.57 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.96 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|