C22H24ClFN4O4 — CID 67992738
1-[3-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carbonyl)-2-methoxyphenyl]-3-(2-chloro-3-fluorophenyl)urea (PubChem CID 67992738) has the molecular formula C22H24ClFN4O4 and a molecular weight of 462.91 g/mol. Its IUPAC name is 1-[3-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carbonyl)-2-methoxyphenyl]-3-(2-chloro-3-fluorophenyl)urea.
| Compound Name | 1-[3-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carbonyl)-2-methoxyphenyl]-3-(2-chloro-3-fluorophenyl)urea |
|---|---|
| PubChem CID | 67992738 |
| Molecular Formula | C22H24ClFN4O4 |
| Molecular Weight | 462.91 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 1-[3-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carbonyl)-2-methoxyphenyl]-3-(2-chloro-3-fluorophenyl)urea |
| SMILES | COc1c(NC(=O)Nc2cccc(F)c2Cl)cccc1C(=O)N1CCN2CCOCC2C1 |
| InChI | InChI=1S/C22H24ClFN4O4/c1-31-20-15(21(29)28-9-8-27-10-11-32-13-14(27)12-28)4-2-7-18(20)26-22(30)25-17-6-3-5-16(24)19(17)23/h2-7,14H,8-13H2,1H3,(H2,25,26,30) |
| InChIKey | ZTMBKVUCRFMSEX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.91 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |