C30H36ClFN6O5 — CID 87078939
N-[(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-[4-(2-hydroxyethyl)piperazin-1-yl]-5-oxopentoxy]-N-isoquinolin-3-ylformamide (PubChem CID 87078939) has the molecular formula C30H36ClFN6O5 and a molecular weight of 615.11 g/mol. Its IUPAC name is N-[(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-[4-(2-hydroxyethyl)piperazin-1-yl]-5-oxopentoxy]-N-isoquinolin-3-ylformamide.
| Compound Name | N-[(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-[4-(2-hydroxyethyl)piperazin-1-yl]-5-oxopentoxy]-N-isoquinolin-3-ylformamide |
|---|---|
| PubChem CID | 87078939 |
| Molecular Formula | C30H36ClFN6O5 |
| Molecular Weight | 615.11 g/mol |
| Exact Mass | 614.24 |
| IUPAC Name | N-[(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-[4-(2-hydroxyethyl)piperazin-1-yl]-5-oxopentoxy]-N-isoquinolin-3-ylformamide |
| SMILES | CC(=O)N(NCc1cccc(F)c1Cl)[C@@H](CCC(=O)N1CCN(CCO)CC1)CON(C=O)c1cc2ccccc2cn1 |
| InChI | InChI=1S/C30H36ClFN6O5/c1-22(41)38(34-19-25-7-4-8-27(32)30(25)31)26(9-10-29(42)36-13-11-35(12-14-36)15-16-39)20-43-37(21-40)28-17-23-5-2-3-6-24(23)18-33-28/h2-8,17-18,21,26,34,39H,9-16,19-20H2,1H3/t26-/m0/s1 |
| InChIKey | ZSEKBUDDJCQMRO-SANMLTNESA-N |
| XLogP | 2.76 |
| TPSA | 118.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.11 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|